About 2-[[[2-(2-cyclopentyl-1,3-thiazol-4-yl)acetyl]amino]methyl]benzoic acid
2-[[[2-(2-cyclopentyl-1,3-thiazol-4-yl)acetyl]amino]methyl]benzoic acid (PubChem CID 166253613) has the molecular formula C18H20N2O3S
and a molecular weight of 344.44 g/mol. Its IUPAC name is 2-[[[2-(2-cyclopentyl-1,3-thiazol-4-yl)acetyl]amino]methyl]benzoic acid.
Molecular Properties
| Compound Name | 2-[[[2-(2-cyclopentyl-1,3-thiazol-4-yl)acetyl]amino]methyl]benzoic acid |
| PubChem CID | 166253613 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 2-[[[2-(2-cyclopentyl-1,3-thiazol-4-yl)acetyl]amino]methyl]benzoic acid |
| SMILES | O=C(Cc1csc(C2CCCC2)n1)NCc1ccccc1C(=O)O |
| InChI | InChI=1S/C18H20N2O3S/c21-16(19-10-13-7-3-4-8-15(13)18(22)23)9-14-11-24-17(20-14)12-5-1-2-6-12/h3-4,7-8,11-12H,1-2,5-6,9-10H2,(H,19,21)(H,22,23) |
| InChIKey | GUKVAMINWRVQFW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[[2-(2-cyclopentyl-1,3-thiazol-4-yl)acetyl]amino]methyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[[2-(2-cyclopentyl-1,3-thiazol-4-yl)acetyl]amino]methyl]benzoic acid?
The IUPAC name of 2-[[[2-(2-cyclopentyl-1,3-thiazol-4-yl)acetyl]amino]methyl]benzoic acid (CID 166253613) is 2-[[[2-(2-cyclopentyl-1,3-thiazol-4-yl)acetyl]amino]methyl]benzoic acid.
What is the SMILES notation for 2-[[[2-(2-cyclopentyl-1,3-thiazol-4-yl)acetyl]amino]methyl]benzoic acid?
The canonical SMILES for 2-[[[2-(2-cyclopentyl-1,3-thiazol-4-yl)acetyl]amino]methyl]benzoic acid is O=C(Cc1csc(C2CCCC2)n1)NCc1ccccc1C(=O)O.
What is the InChIKey of 2-[[[2-(2-cyclopentyl-1,3-thiazol-4-yl)acetyl]amino]methyl]benzoic acid?
The InChIKey is GUKVAMINWRVQFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O3S/c21-16(19-10-13-7-3-4-8-15(13)18(22)23)9-14-11-24-17(20-14)12-5-1-2-6-12/h3-4,7-8,11-12H,1-2,5-6,9-10H2,(H,19,21)(H,22,23).
What are the key properties of 2-[[[2-(2-cyclopentyl-1,3-thiazol-4-yl)acetyl]amino]methyl]benzoic acid?
2-[[[2-(2-cyclopentyl-1,3-thiazol-4-yl)acetyl]amino]methyl]benzoic acid has a molecular weight of 344.44 g/mol, XLogP of 3.36, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[[2-(2-cyclopentyl-1,3-thiazol-4-yl)acetyl]amino]methyl]benzoic acid is sourced from PubChem (CID 166253613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).