C13H22N2S — CID 70641697
4-butyl-2-(1-methylpiperidin-4-yl)-1,3-thiazole (PubChem CID 70641697) has the molecular formula C13H22N2S and a molecular weight of 238.40 g/mol. Its IUPAC name is 4-butyl-2-(1-methylpiperidin-4-yl)-1,3-thiazole.
| Compound Name | 4-butyl-2-(1-methylpiperidin-4-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 70641697 |
| Molecular Formula | C13H22N2S |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 4-butyl-2-(1-methylpiperidin-4-yl)-1,3-thiazole |
| SMILES | CCCCc1csc(C2CCN(C)CC2)n1 |
| InChI | InChI=1S/C13H22N2S/c1-3-4-5-12-10-16-13(14-12)11-6-8-15(2)9-7-11/h10-11H,3-9H2,1-2H3 |
| InChIKey | WMMBZMAGUIYRTC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |