C10H13NO2S2 — CID 115087775
3-[2-(thiolan-3-yl)-1,3-thiazol-4-yl]propanoic acid (PubChem CID 115087775) has the molecular formula C10H13NO2S2 and a molecular weight of 243.35 g/mol. Its IUPAC name is 3-[2-(thiolan-3-yl)-1,3-thiazol-4-yl]propanoic acid.
| Compound Name | 3-[2-(thiolan-3-yl)-1,3-thiazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 115087775 |
| Molecular Formula | C10H13NO2S2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | 3-[2-(thiolan-3-yl)-1,3-thiazol-4-yl]propanoic acid |
| SMILES | O=C(O)CCc1csc(C2CCSC2)n1 |
| InChI | InChI=1S/C10H13NO2S2/c12-9(13)2-1-8-6-15-10(11-8)7-3-4-14-5-7/h6-7H,1-5H2,(H,12,13) |
| InChIKey | RSSMKWNOKWJMEE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |