3-[2-(thian-4-ylmethyl)-1,3-thiazol-4-yl]propanoic acid

C12H17NO2S2 — CID 115088202

IUPAC3-[2-(thian-4-ylmethyl)-1,3-thiazol-4-yl]propanoic acid
SMILESO=C(O)CCc1csc(CC2CCSCC2)n1
InChIInChI=1S/C12H17NO2S2/c14-12(15)2-1-10-8-17-11(13-10)7-9-3-5-16-6-4-9/h8-9H,1-7H2,(H,14,15)
InChIKeyYZLNTTAZCWUEGF-UHFFFAOYSA-N
MW271.41 g/mol
LogP2.85
Rot. Bonds5

About 3-[2-(thian-4-ylmethyl)-1,3-thiazol-4-yl]propanoic acid

3-[2-(thian-4-ylmethyl)-1,3-thiazol-4-yl]propanoic acid (PubChem CID 115088202) has the molecular formula C12H17NO2S2 and a molecular weight of 271.41 g/mol. Its IUPAC name is 3-[2-(thian-4-ylmethyl)-1,3-thiazol-4-yl]propanoic acid.

Molecular Properties

Compound Name3-[2-(thian-4-ylmethyl)-1,3-thiazol-4-yl]propanoic acid
PubChem CID115088202
Molecular FormulaC12H17NO2S2
Molecular Weight271.41 g/mol
Exact Mass271.07
IUPAC Name3-[2-(thian-4-ylmethyl)-1,3-thiazol-4-yl]propanoic acid
SMILESO=C(O)CCc1csc(CC2CCSCC2)n1
InChIInChI=1S/C12H17NO2S2/c14-12(15)2-1-10-8-17-11(13-10)7-9-3-5-16-6-4-9/h8-9H,1-7H2,(H,14,15)
InChIKeyYZLNTTAZCWUEGF-UHFFFAOYSA-N
XLogP2.85
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.41
LogP ≤ 52.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-[2-(thian-4-ylmethyl)-1,3-thiazol-4-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-(thian-4-ylmethyl)-1,3-thiazol-4-yl]propanoic acid?
The IUPAC name of 3-[2-(thian-4-ylmethyl)-1,3-thiazol-4-yl]propanoic acid (CID 115088202) is 3-[2-(thian-4-ylmethyl)-1,3-thiazol-4-yl]propanoic acid.
What is the SMILES notation for 3-[2-(thian-4-ylmethyl)-1,3-thiazol-4-yl]propanoic acid?
The canonical SMILES for 3-[2-(thian-4-ylmethyl)-1,3-thiazol-4-yl]propanoic acid is O=C(O)CCc1csc(CC2CCSCC2)n1.
What is the InChIKey of 3-[2-(thian-4-ylmethyl)-1,3-thiazol-4-yl]propanoic acid?
The InChIKey is YZLNTTAZCWUEGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2S2/c14-12(15)2-1-10-8-17-11(13-10)7-9-3-5-16-6-4-9/h8-9H,1-7H2,(H,14,15).
What are the key properties of 3-[2-(thian-4-ylmethyl)-1,3-thiazol-4-yl]propanoic acid?
3-[2-(thian-4-ylmethyl)-1,3-thiazol-4-yl]propanoic acid has a molecular weight of 271.41 g/mol, XLogP of 2.85, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(thian-4-ylmethyl)-1,3-thiazol-4-yl]propanoic acid is sourced from PubChem (CID 115088202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).