C11H15NOS2 — CID 115087946
1-[2-(thiolan-3-ylmethyl)-1,3-thiazol-4-yl]propan-2-one (PubChem CID 115087946) has the molecular formula C11H15NOS2 and a molecular weight of 241.38 g/mol. Its IUPAC name is 1-[2-(thiolan-3-ylmethyl)-1,3-thiazol-4-yl]propan-2-one.
| Compound Name | 1-[2-(thiolan-3-ylmethyl)-1,3-thiazol-4-yl]propan-2-one |
|---|---|
| PubChem CID | 115087946 |
| Molecular Formula | C11H15NOS2 |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 1-[2-(thiolan-3-ylmethyl)-1,3-thiazol-4-yl]propan-2-one |
| SMILES | CC(=O)Cc1csc(CC2CCSC2)n1 |
| InChI | InChI=1S/C11H15NOS2/c1-8(13)4-10-7-15-11(12-10)5-9-2-3-14-6-9/h7,9H,2-6H2,1H3 |
| InChIKey | SUYQYURTYMHOOJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |