C16H17NO2S — CID 119050942
[4-[[2-(cyclopropylmethyl)-1,3-thiazol-4-yl]methyl]phenyl] acetate (PubChem CID 119050942) has the molecular formula C16H17NO2S and a molecular weight of 287.38 g/mol. Its IUPAC name is [4-[[2-(cyclopropylmethyl)-1,3-thiazol-4-yl]methyl]phenyl] acetate.
| Compound Name | [4-[[2-(cyclopropylmethyl)-1,3-thiazol-4-yl]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 119050942 |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | [4-[[2-(cyclopropylmethyl)-1,3-thiazol-4-yl]methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(Cc2csc(CC3CC3)n2)cc1 |
| InChI | InChI=1S/C16H17NO2S/c1-11(18)19-15-6-4-12(5-7-15)8-14-10-20-16(17-14)9-13-2-3-13/h4-7,10,13H,2-3,8-9H2,1H3 |
| InChIKey | JVOBGUKBAIIZPV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|