C7H9NO3S2 — CID 130501450
2-(1,1-dioxothiolan-3-yl)-1,3-thiazol-4-ol (PubChem CID 130501450) has the molecular formula C7H9NO3S2 and a molecular weight of 219.29 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-1,3-thiazol-4-ol.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-1,3-thiazol-4-ol |
|---|---|
| PubChem CID | 130501450 |
| Molecular Formula | C7H9NO3S2 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.00 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-1,3-thiazol-4-ol |
| SMILES | O=S1(=O)CCC(c2nc(O)cs2)C1 |
| InChI | InChI=1S/C7H9NO3S2/c9-6-3-12-7(8-6)5-1-2-13(10,11)4-5/h3,5,9H,1-2,4H2 |
| InChIKey | KFOFDAVGNHCAAR-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |