C8H8Cl2N2O2S — CID 115336168
3-(4,6-dichloropyrimidin-2-yl)thiolane 1,1-dioxide (PubChem CID 115336168) has the molecular formula C8H8Cl2N2O2S and a molecular weight of 267.14 g/mol. Its IUPAC name is 3-(4,6-dichloropyrimidin-2-yl)thiolane 1,1-dioxide.
| Compound Name | 3-(4,6-dichloropyrimidin-2-yl)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 115336168 |
| Molecular Formula | C8H8Cl2N2O2S |
| Molecular Weight | 267.14 g/mol |
| Exact Mass | 265.97 |
| IUPAC Name | 3-(4,6-dichloropyrimidin-2-yl)thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(c2nc(Cl)cc(Cl)n2)C1 |
| InChI | InChI=1S/C8H8Cl2N2O2S/c9-6-3-7(10)12-8(11-6)5-1-2-15(13,14)4-5/h3,5H,1-2,4H2 |
| InChIKey | QUVTVGGMCMOJIA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.14 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |