C12H19N3O2S — CID 115337211
2-(1,1-dioxothiolan-3-yl)-N-methyl-6-propylpyrimidin-4-amine (PubChem CID 115337211) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-N-methyl-6-propylpyrimidin-4-amine.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-N-methyl-6-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 115337211 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-N-methyl-6-propylpyrimidin-4-amine |
| SMILES | CCCc1cc(NC)nc(C2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C12H19N3O2S/c1-3-4-10-7-11(13-2)15-12(14-10)9-5-6-18(16,17)8-9/h7,9H,3-6,8H2,1-2H3,(H,13,14,15) |
| InChIKey | KHCLKWSBDXAXDX-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |