C11H16IN3O2S — CID 113289855
2-(1,1-dioxothiolan-3-yl)-5-iodo-6-propylpyrimidin-4-amine (PubChem CID 113289855) has the molecular formula C11H16IN3O2S and a molecular weight of 381.24 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-5-iodo-6-propylpyrimidin-4-amine.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-5-iodo-6-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 113289855 |
| Molecular Formula | C11H16IN3O2S |
| Molecular Weight | 381.24 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-5-iodo-6-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(C2CCS(=O)(=O)C2)nc(N)c1I |
| InChI | InChI=1S/C11H16IN3O2S/c1-2-3-8-9(12)10(13)15-11(14-8)7-4-5-18(16,17)6-7/h7H,2-6H2,1H3,(H2,13,14,15) |
| InChIKey | UKPUSMWXTGKGJZ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.24 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|