About 2-(1,1-dioxothiolan-3-yl)-5-iodo-6-propylpyrimidin-4-amine
2-(1,1-dioxothiolan-3-yl)-5-iodo-6-propylpyrimidin-4-amine (PubChem CID 113289855) has the molecular formula C11H16IN3O2S
and a molecular weight of 381.24 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-5-iodo-6-propylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-5-iodo-6-propylpyrimidin-4-amine |
| PubChem CID | 113289855 |
| Molecular Formula | C11H16IN3O2S |
| Molecular Weight | 381.24 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-5-iodo-6-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(C2CCS(=O)(=O)C2)nc(N)c1I |
| InChI | InChI=1S/C11H16IN3O2S/c1-2-3-8-9(12)10(13)15-11(14-8)7-4-5-18(16,17)6-7/h7H,2-6H2,1H3,(H2,13,14,15) |
| InChIKey | UKPUSMWXTGKGJZ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.24 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,1-dioxothiolan-3-yl)-5-iodo-6-propylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-dioxothiolan-3-yl)-5-iodo-6-propylpyrimidin-4-amine?
The IUPAC name of 2-(1,1-dioxothiolan-3-yl)-5-iodo-6-propylpyrimidin-4-amine (CID 113289855) is 2-(1,1-dioxothiolan-3-yl)-5-iodo-6-propylpyrimidin-4-amine.
What is the SMILES notation for 2-(1,1-dioxothiolan-3-yl)-5-iodo-6-propylpyrimidin-4-amine?
The canonical SMILES for 2-(1,1-dioxothiolan-3-yl)-5-iodo-6-propylpyrimidin-4-amine is CCCc1nc(C2CCS(=O)(=O)C2)nc(N)c1I.
What is the InChIKey of 2-(1,1-dioxothiolan-3-yl)-5-iodo-6-propylpyrimidin-4-amine?
The InChIKey is UKPUSMWXTGKGJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16IN3O2S/c1-2-3-8-9(12)10(13)15-11(14-8)7-4-5-18(16,17)6-7/h7H,2-6H2,1H3,(H2,13,14,15).
What are the key properties of 2-(1,1-dioxothiolan-3-yl)-5-iodo-6-propylpyrimidin-4-amine?
2-(1,1-dioxothiolan-3-yl)-5-iodo-6-propylpyrimidin-4-amine has a molecular weight of 381.24 g/mol, XLogP of 1.52, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxothiolan-3-yl)-5-iodo-6-propylpyrimidin-4-amine is sourced from PubChem (CID 113289855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).