C10H14IN3O3S — CID 113289859
2-(1,1-dioxothiolan-3-yl)-5-iodo-6-(methoxymethyl)pyrimidin-4-amine (PubChem CID 113289859) has the molecular formula C10H14IN3O3S and a molecular weight of 383.21 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-5-iodo-6-(methoxymethyl)pyrimidin-4-amine.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-5-iodo-6-(methoxymethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 113289859 |
| Molecular Formula | C10H14IN3O3S |
| Molecular Weight | 383.21 g/mol |
| Exact Mass | 382.98 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-5-iodo-6-(methoxymethyl)pyrimidin-4-amine |
| SMILES | COCc1nc(C2CCS(=O)(=O)C2)nc(N)c1I |
| InChI | InChI=1S/C10H14IN3O3S/c1-17-4-7-8(11)9(12)14-10(13-7)6-2-3-18(15,16)5-6/h6H,2-5H2,1H3,(H2,12,13,14) |
| InChIKey | YKEXFQPTAIDOIO-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.21 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|