C10H12BrClN2O2S — CID 115336186
3-(5-bromo-4-chloro-6-ethylpyrimidin-2-yl)thiolane 1,1-dioxide (PubChem CID 115336186) has the molecular formula C10H12BrClN2O2S and a molecular weight of 339.64 g/mol. Its IUPAC name is 3-(5-bromo-4-chloro-6-ethylpyrimidin-2-yl)thiolane 1,1-dioxide.
| Compound Name | 3-(5-bromo-4-chloro-6-ethylpyrimidin-2-yl)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 115336186 |
| Molecular Formula | C10H12BrClN2O2S |
| Molecular Weight | 339.64 g/mol |
| Exact Mass | 337.95 |
| IUPAC Name | 3-(5-bromo-4-chloro-6-ethylpyrimidin-2-yl)thiolane 1,1-dioxide |
| SMILES | CCc1nc(C2CCS(=O)(=O)C2)nc(Cl)c1Br |
| InChI | InChI=1S/C10H12BrClN2O2S/c1-2-7-8(11)9(12)14-10(13-7)6-3-4-17(15,16)5-6/h6H,2-5H2,1H3 |
| InChIKey | FWBRHOAWRMWPIB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.64 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |