C10H12N2O4S — CID 115337398
2-(1,1-dioxothiolan-3-yl)-6-methylpyrimidine-4-carboxylic acid (PubChem CID 115337398) has the molecular formula C10H12N2O4S and a molecular weight of 256.28 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-6-methylpyrimidine-4-carboxylic acid.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-6-methylpyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 115337398 |
| Molecular Formula | C10H12N2O4S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-6-methylpyrimidine-4-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)nc(C2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C10H12N2O4S/c1-6-4-8(10(13)14)12-9(11-6)7-2-3-17(15,16)5-7/h4,7H,2-3,5H2,1H3,(H,13,14) |
| InChIKey | DJRIPFFFOAUHTC-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |