2-(1,1-dioxothiolan-3-yl)-6-methylpyrimidine-4-carboxylic acid

C10H12N2O4S — CID 115337398

IUPAC2-(1,1-dioxothiolan-3-yl)-6-methylpyrimidine-4-carboxylic acid
SMILESCc1cc(C(=O)O)nc(C2CCS(=O)(=O)C2)n1
InChIInChI=1S/C10H12N2O4S/c1-6-4-8(10(13)14)12-9(11-6)7-2-3-17(15,16)5-7/h4,7H,2-3,5H2,1H3,(H,13,14)
InChIKeyDJRIPFFFOAUHTC-UHFFFAOYSA-N
MW256.28 g/mol
LogP0.39
Rot. Bonds2

About 2-(1,1-dioxothiolan-3-yl)-6-methylpyrimidine-4-carboxylic acid

2-(1,1-dioxothiolan-3-yl)-6-methylpyrimidine-4-carboxylic acid (PubChem CID 115337398) has the molecular formula C10H12N2O4S and a molecular weight of 256.28 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-6-methylpyrimidine-4-carboxylic acid.

Molecular Properties

Compound Name2-(1,1-dioxothiolan-3-yl)-6-methylpyrimidine-4-carboxylic acid
PubChem CID115337398
Molecular FormulaC10H12N2O4S
Molecular Weight256.28 g/mol
Exact Mass256.05
IUPAC Name2-(1,1-dioxothiolan-3-yl)-6-methylpyrimidine-4-carboxylic acid
SMILESCc1cc(C(=O)O)nc(C2CCS(=O)(=O)C2)n1
InChIInChI=1S/C10H12N2O4S/c1-6-4-8(10(13)14)12-9(11-6)7-2-3-17(15,16)5-7/h4,7H,2-3,5H2,1H3,(H,13,14)
InChIKeyDJRIPFFFOAUHTC-UHFFFAOYSA-N
XLogP0.39
TPSA97.22 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.28
LogP ≤ 50.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-(1,1-dioxothiolan-3-yl)-6-methylpyrimidine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,1-dioxothiolan-3-yl)-6-methylpyrimidine-4-carboxylic acid?
The IUPAC name of 2-(1,1-dioxothiolan-3-yl)-6-methylpyrimidine-4-carboxylic acid (CID 115337398) is 2-(1,1-dioxothiolan-3-yl)-6-methylpyrimidine-4-carboxylic acid.
What is the SMILES notation for 2-(1,1-dioxothiolan-3-yl)-6-methylpyrimidine-4-carboxylic acid?
The canonical SMILES for 2-(1,1-dioxothiolan-3-yl)-6-methylpyrimidine-4-carboxylic acid is Cc1cc(C(=O)O)nc(C2CCS(=O)(=O)C2)n1.
What is the InChIKey of 2-(1,1-dioxothiolan-3-yl)-6-methylpyrimidine-4-carboxylic acid?
The InChIKey is DJRIPFFFOAUHTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O4S/c1-6-4-8(10(13)14)12-9(11-6)7-2-3-17(15,16)5-7/h4,7H,2-3,5H2,1H3,(H,13,14).
What are the key properties of 2-(1,1-dioxothiolan-3-yl)-6-methylpyrimidine-4-carboxylic acid?
2-(1,1-dioxothiolan-3-yl)-6-methylpyrimidine-4-carboxylic acid has a molecular weight of 256.28 g/mol, XLogP of 0.39, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxothiolan-3-yl)-6-methylpyrimidine-4-carboxylic acid is sourced from PubChem (CID 115337398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).