C11H16N2O3S — CID 103431589
(1S)-1-[2-(1,1-dioxothiolan-3-yl)-4-methylpyrimidin-5-yl]ethanol (PubChem CID 103431589) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is (1S)-1-[2-(1,1-dioxothiolan-3-yl)-4-methylpyrimidin-5-yl]ethanol.
| Compound Name | (1S)-1-[2-(1,1-dioxothiolan-3-yl)-4-methylpyrimidin-5-yl]ethanol |
|---|---|
| PubChem CID | 103431589 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | (1S)-1-[2-(1,1-dioxothiolan-3-yl)-4-methylpyrimidin-5-yl]ethanol |
| SMILES | Cc1nc(C2CCS(=O)(=O)C2)ncc1[C@H](C)O |
| InChI | InChI=1S/C11H16N2O3S/c1-7-10(8(2)14)5-12-11(13-7)9-3-4-17(15,16)6-9/h5,8-9,14H,3-4,6H2,1-2H3/t8-,9?/m0/s1 |
| InChIKey | DXTMLPUWJLVYCJ-IENPIDJESA-N |
| XLogP | 0.74 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |