C15H22Cl2N2 — CID 123163685
4,6-dichloro-2-cycloundecylpyrimidine (PubChem CID 123163685) has the molecular formula C15H22Cl2N2 and a molecular weight of 301.26 g/mol. Its IUPAC name is 4,6-dichloro-2-cycloundecylpyrimidine.
| Compound Name | 4,6-dichloro-2-cycloundecylpyrimidine |
|---|---|
| PubChem CID | 123163685 |
| Molecular Formula | C15H22Cl2N2 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 4,6-dichloro-2-cycloundecylpyrimidine |
| SMILES | Clc1cc(Cl)nc(C2CCCCCCCCCC2)n1 |
| InChI | InChI=1S/C15H22Cl2N2/c16-13-11-14(17)19-15(18-13)12-9-7-5-3-1-2-4-6-8-10-12/h11-12H,1-10H2 |
| InChIKey | XWEOXVRQTCCNIM-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |