C9H12ClN3 — CID 116823809
5-chloro-3-cyclohexyl-1,2,4-triazine (PubChem CID 116823809) has the molecular formula C9H12ClN3 and a molecular weight of 197.67 g/mol. Its IUPAC name is 5-chloro-3-cyclohexyl-1,2,4-triazine.
| Compound Name | 5-chloro-3-cyclohexyl-1,2,4-triazine |
|---|---|
| PubChem CID | 116823809 |
| Molecular Formula | C9H12ClN3 |
| Molecular Weight | 197.67 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 5-chloro-3-cyclohexyl-1,2,4-triazine |
| SMILES | Clc1cnnc(C2CCCCC2)n1 |
| InChI | InChI=1S/C9H12ClN3/c10-8-6-11-13-9(12-8)7-4-2-1-3-5-7/h6-7H,1-5H2 |
| InChIKey | OITADAYYIAYFBS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.67 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |