C10H16N4 — CID 116823977
3-cyclohexyl-N-methyl-1,2,4-triazin-5-amine (PubChem CID 116823977) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is 3-cyclohexyl-N-methyl-1,2,4-triazin-5-amine.
| Compound Name | 3-cyclohexyl-N-methyl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 116823977 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 3-cyclohexyl-N-methyl-1,2,4-triazin-5-amine |
| SMILES | CNc1cnnc(C2CCCCC2)n1 |
| InChI | InChI=1S/C10H16N4/c1-11-9-7-12-14-10(13-9)8-5-3-2-4-6-8/h7-8H,2-6H2,1H3,(H,11,13,14) |
| InChIKey | GRCMVASYSNAISC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |