C10H17N5 — CID 67217441
6-cyclohexyl-2-N-methyl-1,3,5-triazine-2,4-diamine (PubChem CID 67217441) has the molecular formula C10H17N5 and a molecular weight of 207.28 g/mol. Its IUPAC name is 6-cyclohexyl-2-N-methyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-cyclohexyl-2-N-methyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 67217441 |
| Molecular Formula | C10H17N5 |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | 6-cyclohexyl-2-N-methyl-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(N)nc(C2CCCCC2)n1 |
| InChI | InChI=1S/C10H17N5/c1-12-10-14-8(13-9(11)15-10)7-5-3-2-4-6-7/h7H,2-6H2,1H3,(H3,11,12,13,14,15) |
| InChIKey | XZTNEDZPHXYCDG-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |