C13H23N5 — CID 55251716
6-cyclohexyl-2-N,2-N-diethyl-1,3,5-triazine-2,4-diamine (PubChem CID 55251716) has the molecular formula C13H23N5 and a molecular weight of 249.36 g/mol. Its IUPAC name is 6-cyclohexyl-2-N,2-N-diethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-cyclohexyl-2-N,2-N-diethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 55251716 |
| Molecular Formula | C13H23N5 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.20 |
| IUPAC Name | 6-cyclohexyl-2-N,2-N-diethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCN(CC)c1nc(N)nc(C2CCCCC2)n1 |
| InChI | InChI=1S/C13H23N5/c1-3-18(4-2)13-16-11(15-12(14)17-13)10-8-6-5-7-9-10/h10H,3-9H2,1-2H3,(H2,14,15,16,17) |
| InChIKey | WUMWARGDWMLPOC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |