C17H28N4 — CID 65401606
4-cyclopentyl-6-(4-propan-2-ylcyclohexyl)-1,3,5-triazin-2-amine (PubChem CID 65401606) has the molecular formula C17H28N4 and a molecular weight of 288.44 g/mol. Its IUPAC name is 4-cyclopentyl-6-(4-propan-2-ylcyclohexyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-cyclopentyl-6-(4-propan-2-ylcyclohexyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 65401606 |
| Molecular Formula | C17H28N4 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 4-cyclopentyl-6-(4-propan-2-ylcyclohexyl)-1,3,5-triazin-2-amine |
| SMILES | CC(C)C1CCC(c2nc(N)nc(C3CCCC3)n2)CC1 |
| InChI | InChI=1S/C17H28N4/c1-11(2)12-7-9-14(10-8-12)16-19-15(20-17(18)21-16)13-5-3-4-6-13/h11-14H,3-10H2,1-2H3,(H2,18,19,20,21) |
| InChIKey | YCOXGOULHONZDU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |