C14H22N4S2 — CID 115389198
4-cyclohexyl-6-(3-methyl-1,4-dithian-2-yl)-1,3,5-triazin-2-amine (PubChem CID 115389198) has the molecular formula C14H22N4S2 and a molecular weight of 310.49 g/mol. Its IUPAC name is 4-cyclohexyl-6-(3-methyl-1,4-dithian-2-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-cyclohexyl-6-(3-methyl-1,4-dithian-2-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 115389198 |
| Molecular Formula | C14H22N4S2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 4-cyclohexyl-6-(3-methyl-1,4-dithian-2-yl)-1,3,5-triazin-2-amine |
| SMILES | CC1SCCSC1c1nc(N)nc(C2CCCCC2)n1 |
| InChI | InChI=1S/C14H22N4S2/c1-9-11(20-8-7-19-9)13-16-12(17-14(15)18-13)10-5-3-2-4-6-10/h9-11H,2-8H2,1H3,(H2,15,16,17,18) |
| InChIKey | MPRHHZRVHLKHSJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |