C13H22N4 — CID 80785345
2-N-cyclooctyl-6-N-methylpyrazine-2,6-diamine (PubChem CID 80785345) has the molecular formula C13H22N4 and a molecular weight of 234.35 g/mol. Its IUPAC name is 2-N-cyclooctyl-6-N-methylpyrazine-2,6-diamine.
| Compound Name | 2-N-cyclooctyl-6-N-methylpyrazine-2,6-diamine |
|---|---|
| PubChem CID | 80785345 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 2-N-cyclooctyl-6-N-methylpyrazine-2,6-diamine |
| SMILES | CNc1cncc(NC2CCCCCCC2)n1 |
| InChI | InChI=1S/C13H22N4/c1-14-12-9-15-10-13(17-12)16-11-7-5-3-2-4-6-8-11/h9-11H,2-8H2,1H3,(H2,14,16,17) |
| InChIKey | SEMMUELKPITJLL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |