C17H25N5 — CID 71885724
N-cyclooctyl-6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-amine (PubChem CID 71885724) has the molecular formula C17H25N5 and a molecular weight of 299.42 g/mol. Its IUPAC name is N-cyclooctyl-6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-amine.
| Compound Name | N-cyclooctyl-6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 71885724 |
| Molecular Formula | C17H25N5 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | N-cyclooctyl-6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-amine |
| SMILES | Cc1cc(C)n(-c2cncc(NC3CCCCCCC3)n2)n1 |
| InChI | InChI=1S/C17H25N5/c1-13-10-14(2)22(21-13)17-12-18-11-16(20-17)19-15-8-6-4-3-5-7-9-15/h10-12,15H,3-9H2,1-2H3,(H,19,20) |
| InChIKey | AICWXMUPBKWNPV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |