C13H19N7 — CID 578915
N-cyclohexyl-6-(3,5-dimethylpyrazol-1-yl)-1,2,4,5-tetrazin-3-amine (PubChem CID 578915) has the molecular formula C13H19N7 and a molecular weight of 273.34 g/mol. Its IUPAC name is N-cyclohexyl-6-(3,5-dimethylpyrazol-1-yl)-1,2,4,5-tetrazin-3-amine.
| Compound Name | N-cyclohexyl-6-(3,5-dimethylpyrazol-1-yl)-1,2,4,5-tetrazin-3-amine |
|---|---|
| PubChem CID | 578915 |
| Molecular Formula | C13H19N7 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | N-cyclohexyl-6-(3,5-dimethylpyrazol-1-yl)-1,2,4,5-tetrazin-3-amine |
| SMILES | Cc1cc(C)n(-c2nnc(NC3CCCCC3)nn2)n1 |
| InChI | InChI=1S/C13H19N7/c1-9-8-10(2)20(19-9)13-17-15-12(16-18-13)14-11-6-4-3-5-7-11/h8,11H,3-7H2,1-2H3,(H,14,15,16) |
| InChIKey | DEBMDTKQWCJVER-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|