C9H13N7 — CID 127043905
N-cyclohexyl-[1,2,4]triazolo[4,3-b][1,2,4,5]tetrazin-6-amine (PubChem CID 127043905) has the molecular formula C9H13N7 and a molecular weight of 219.25 g/mol. Its IUPAC name is N-cyclohexyl-[1,2,4]triazolo[4,3-b][1,2,4,5]tetrazin-6-amine.
| Compound Name | N-cyclohexyl-[1,2,4]triazolo[4,3-b][1,2,4,5]tetrazin-6-amine |
|---|---|
| PubChem CID | 127043905 |
| Molecular Formula | C9H13N7 |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | N-cyclohexyl-[1,2,4]triazolo[4,3-b][1,2,4,5]tetrazin-6-amine |
| SMILES | c1nnc2nnc(NC3CCCCC3)nn12 |
| InChI | InChI=1S/C9H13N7/c1-2-4-7(5-3-1)11-8-12-14-9-13-10-6-16(9)15-8/h6-7H,1-5H2,(H,11,15) |
| InChIKey | AZHUGXVRBVCAGB-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|