C13H21N5 — CID 112941042
N-cyclohexyl-5-pyrrolidin-1-yl-1,2,4-triazin-3-amine (PubChem CID 112941042) has the molecular formula C13H21N5 and a molecular weight of 247.35 g/mol. Its IUPAC name is N-cyclohexyl-5-pyrrolidin-1-yl-1,2,4-triazin-3-amine.
| Compound Name | N-cyclohexyl-5-pyrrolidin-1-yl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 112941042 |
| Molecular Formula | C13H21N5 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | N-cyclohexyl-5-pyrrolidin-1-yl-1,2,4-triazin-3-amine |
| SMILES | c1nnc(NC2CCCCC2)nc1N1CCCC1 |
| InChI | InChI=1S/C13H21N5/c1-2-6-11(7-3-1)15-13-16-12(10-14-17-13)18-8-4-5-9-18/h10-11H,1-9H2,(H,15,16,17) |
| InChIKey | UZMMZIQWCLIEHN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |