C15H26N6 — CID 112942382
N-cyclohexyl-5-(4-ethylpiperazin-1-yl)-1,2,4-triazin-3-amine (PubChem CID 112942382) has the molecular formula C15H26N6 and a molecular weight of 290.41 g/mol. Its IUPAC name is N-cyclohexyl-5-(4-ethylpiperazin-1-yl)-1,2,4-triazin-3-amine.
| Compound Name | N-cyclohexyl-5-(4-ethylpiperazin-1-yl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 112942382 |
| Molecular Formula | C15H26N6 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | N-cyclohexyl-5-(4-ethylpiperazin-1-yl)-1,2,4-triazin-3-amine |
| SMILES | CCN1CCN(c2cnnc(NC3CCCCC3)n2)CC1 |
| InChI | InChI=1S/C15H26N6/c1-2-20-8-10-21(11-9-20)14-12-16-19-15(18-14)17-13-6-4-3-5-7-13/h12-13H,2-11H2,1H3,(H,17,18,19) |
| InChIKey | MFHIOBDFASQIJA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |