C18H23N5 — CID 112959267
N-cycloheptyl-5-(2,3-dihydroindol-1-yl)-1,2,4-triazin-3-amine (PubChem CID 112959267) has the molecular formula C18H23N5 and a molecular weight of 309.42 g/mol. Its IUPAC name is N-cycloheptyl-5-(2,3-dihydroindol-1-yl)-1,2,4-triazin-3-amine.
| Compound Name | N-cycloheptyl-5-(2,3-dihydroindol-1-yl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 112959267 |
| Molecular Formula | C18H23N5 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | N-cycloheptyl-5-(2,3-dihydroindol-1-yl)-1,2,4-triazin-3-amine |
| SMILES | c1ccc2c(c1)CCN2c1cnnc(NC2CCCCCC2)n1 |
| InChI | InChI=1S/C18H23N5/c1-2-4-9-15(8-3-1)20-18-21-17(13-19-22-18)23-12-11-14-7-5-6-10-16(14)23/h5-7,10,13,15H,1-4,8-9,11-12H2,(H,20,21,22) |
| InChIKey | QIJFANRUYSHXQI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |