C19H19N5 — CID 112949104
5-(2,3-dihydroindol-1-yl)-N-(1-phenylethyl)-1,2,4-triazin-3-amine (PubChem CID 112949104) has the molecular formula C19H19N5 and a molecular weight of 317.40 g/mol. Its IUPAC name is 5-(2,3-dihydroindol-1-yl)-N-(1-phenylethyl)-1,2,4-triazin-3-amine.
| Compound Name | 5-(2,3-dihydroindol-1-yl)-N-(1-phenylethyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 112949104 |
| Molecular Formula | C19H19N5 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 5-(2,3-dihydroindol-1-yl)-N-(1-phenylethyl)-1,2,4-triazin-3-amine |
| SMILES | CC(Nc1nncc(N2CCc3ccccc32)n1)c1ccccc1 |
| InChI | InChI=1S/C19H19N5/c1-14(15-7-3-2-4-8-15)21-19-22-18(13-20-23-19)24-12-11-16-9-5-6-10-17(16)24/h2-10,13-14H,11-12H2,1H3,(H,21,22,23) |
| InChIKey | YZWGOORWKYOAGC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |