C16H20N4 — CID 112883419
4-(2,3-dihydroindol-1-yl)-N-(2-methylpropyl)pyrimidin-2-amine (PubChem CID 112883419) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is 4-(2,3-dihydroindol-1-yl)-N-(2-methylpropyl)pyrimidin-2-amine.
| Compound Name | 4-(2,3-dihydroindol-1-yl)-N-(2-methylpropyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 112883419 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 4-(2,3-dihydroindol-1-yl)-N-(2-methylpropyl)pyrimidin-2-amine |
| SMILES | CC(C)CNc1nccc(N2CCc3ccccc32)n1 |
| InChI | InChI=1S/C16H20N4/c1-12(2)11-18-16-17-9-7-15(19-16)20-10-8-13-5-3-4-6-14(13)20/h3-7,9,12H,8,10-11H2,1-2H3,(H,17,18,19) |
| InChIKey | PISHLBKRRXJLST-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |