C12H10ClN3 — CID 22731926
1-(2-chloropyrimidin-4-yl)-2,3-dihydroindole (PubChem CID 22731926) has the molecular formula C12H10ClN3 and a molecular weight of 231.69 g/mol. Its IUPAC name is 1-(2-chloropyrimidin-4-yl)-2,3-dihydroindole.
| Compound Name | 1-(2-chloropyrimidin-4-yl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 22731926 |
| Molecular Formula | C12H10ClN3 |
| Molecular Weight | 231.69 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 1-(2-chloropyrimidin-4-yl)-2,3-dihydroindole |
| SMILES | Clc1nccc(N2CCc3ccccc32)n1 |
| InChI | InChI=1S/C12H10ClN3/c13-12-14-7-5-11(15-12)16-8-6-9-3-1-2-4-10(9)16/h1-5,7H,6,8H2 |
| InChIKey | DVXCTFIEGLLGJG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.69 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |