C16H18N4 — CID 112884067
1-(2-pyrrolidin-1-ylpyrimidin-4-yl)-2,3-dihydroindole (PubChem CID 112884067) has the molecular formula C16H18N4 and a molecular weight of 266.35 g/mol. Its IUPAC name is 1-(2-pyrrolidin-1-ylpyrimidin-4-yl)-2,3-dihydroindole.
| Compound Name | 1-(2-pyrrolidin-1-ylpyrimidin-4-yl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 112884067 |
| Molecular Formula | C16H18N4 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 1-(2-pyrrolidin-1-ylpyrimidin-4-yl)-2,3-dihydroindole |
| SMILES | c1ccc2c(c1)CCN2c1ccnc(N2CCCC2)n1 |
| InChI | InChI=1S/C16H18N4/c1-2-6-14-13(5-1)8-12-20(14)15-7-9-17-16(18-15)19-10-3-4-11-19/h1-2,5-7,9H,3-4,8,10-12H2 |
| InChIKey | HLBIJCRYKDNUEG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |