C14H17N5 — CID 112938585
5-(2,3-dihydroindol-1-yl)-N-propyl-1,2,4-triazin-3-amine (PubChem CID 112938585) has the molecular formula C14H17N5 and a molecular weight of 255.32 g/mol. Its IUPAC name is 5-(2,3-dihydroindol-1-yl)-N-propyl-1,2,4-triazin-3-amine.
| Compound Name | 5-(2,3-dihydroindol-1-yl)-N-propyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 112938585 |
| Molecular Formula | C14H17N5 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 5-(2,3-dihydroindol-1-yl)-N-propyl-1,2,4-triazin-3-amine |
| SMILES | CCCNc1nncc(N2CCc3ccccc32)n1 |
| InChI | InChI=1S/C14H17N5/c1-2-8-15-14-17-13(10-16-18-14)19-9-7-11-5-3-4-6-12(11)19/h3-6,10H,2,7-9H2,1H3,(H,15,17,18) |
| InChIKey | SBEKCDIVJLFROU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |