C7H13N5 — CID 67803825
N-cyclohexyl-2H-tetrazol-5-amine (PubChem CID 67803825) has the molecular formula C7H13N5 and a molecular weight of 167.22 g/mol. Its IUPAC name is N-cyclohexyl-2H-tetrazol-5-amine.
| Compound Name | N-cyclohexyl-2H-tetrazol-5-amine |
|---|---|
| PubChem CID | 67803825 |
| Molecular Formula | C7H13N5 |
| Molecular Weight | 167.22 g/mol |
| Exact Mass | 167.12 |
| IUPAC Name | N-cyclohexyl-2H-tetrazol-5-amine |
| SMILES | C1CCC(Nc2nn[nH]n2)CC1 |
| InChI | InChI=1S/C7H13N5/c1-2-4-6(5-3-1)8-7-9-11-12-10-7/h6H,1-5H2,(H2,8,9,10,11,12) |
| InChIKey | CCDOVJGJBIIDGD-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |