C17H19N7O — CID 21426371
4-(cyclohexylamino)-N-(2H-tetrazol-5-yl)quinoline-2-carboxamide (PubChem CID 21426371) has the molecular formula C17H19N7O and a molecular weight of 337.39 g/mol. Its IUPAC name is 4-(cyclohexylamino)-N-(2H-tetrazol-5-yl)quinoline-2-carboxamide.
| Compound Name | 4-(cyclohexylamino)-N-(2H-tetrazol-5-yl)quinoline-2-carboxamide |
|---|---|
| PubChem CID | 21426371 |
| Molecular Formula | C17H19N7O |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 4-(cyclohexylamino)-N-(2H-tetrazol-5-yl)quinoline-2-carboxamide |
| SMILES | O=C(Nc1nn[nH]n1)c1cc(NC2CCCCC2)c2ccccc2n1 |
| InChI | InChI=1S/C17H19N7O/c25-16(20-17-21-23-24-22-17)15-10-14(18-11-6-2-1-3-7-11)12-8-4-5-9-13(12)19-15/h4-5,8-11H,1-3,6-7H2,(H,18,19)(H2,20,21,22,23,24,25) |
| InChIKey | DJYFMFTYAXWGAM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |