C14H12N6O — CID 114389478
4-(methylamino)-N-(1,2,4-triazin-3-yl)quinoline-2-carboxamide (PubChem CID 114389478) has the molecular formula C14H12N6O and a molecular weight of 280.29 g/mol. Its IUPAC name is 4-(methylamino)-N-(1,2,4-triazin-3-yl)quinoline-2-carboxamide.
| Compound Name | 4-(methylamino)-N-(1,2,4-triazin-3-yl)quinoline-2-carboxamide |
|---|---|
| PubChem CID | 114389478 |
| Molecular Formula | C14H12N6O |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 4-(methylamino)-N-(1,2,4-triazin-3-yl)quinoline-2-carboxamide |
| SMILES | CNc1cc(C(=O)Nc2nccnn2)nc2ccccc12 |
| InChI | InChI=1S/C14H12N6O/c1-15-11-8-12(18-10-5-3-2-4-9(10)11)13(21)19-14-16-6-7-17-20-14/h2-8H,1H3,(H,15,18)(H,16,19,20,21) |
| InChIKey | IROVACASRCXALE-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 92.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |