C14H12N6O — CID 63375558
4-hydrazinyl-N-pyrazin-2-ylquinoline-2-carboxamide (PubChem CID 63375558) has the molecular formula C14H12N6O and a molecular weight of 280.29 g/mol. Its IUPAC name is 4-hydrazinyl-N-pyrazin-2-ylquinoline-2-carboxamide.
| Compound Name | 4-hydrazinyl-N-pyrazin-2-ylquinoline-2-carboxamide |
|---|---|
| PubChem CID | 63375558 |
| Molecular Formula | C14H12N6O |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 4-hydrazinyl-N-pyrazin-2-ylquinoline-2-carboxamide |
| SMILES | NNc1cc(C(=O)Nc2cnccn2)nc2ccccc12 |
| InChI | InChI=1S/C14H12N6O/c15-20-11-7-12(18-10-4-2-1-3-9(10)11)14(21)19-13-8-16-5-6-17-13/h1-8H,15H2,(H,18,20)(H,17,19,21) |
| InChIKey | GXZXDJRSHFOYOI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|