C15H14N4OS — CID 63375383
4-hydrazinyl-N-(thiophen-2-ylmethyl)quinoline-2-carboxamide (PubChem CID 63375383) has the molecular formula C15H14N4OS and a molecular weight of 298.37 g/mol. Its IUPAC name is 4-hydrazinyl-N-(thiophen-2-ylmethyl)quinoline-2-carboxamide.
| Compound Name | 4-hydrazinyl-N-(thiophen-2-ylmethyl)quinoline-2-carboxamide |
|---|---|
| PubChem CID | 63375383 |
| Molecular Formula | C15H14N4OS |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 4-hydrazinyl-N-(thiophen-2-ylmethyl)quinoline-2-carboxamide |
| SMILES | NNc1cc(C(=O)NCc2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C15H14N4OS/c16-19-13-8-14(18-12-6-2-1-5-11(12)13)15(20)17-9-10-4-3-7-21-10/h1-8H,9,16H2,(H,17,20)(H,18,19) |
| InChIKey | MVNHPITYBVMOCP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|