C11H15N5 — CID 134088447
N-cyclohexyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-amine (PubChem CID 134088447) has the molecular formula C11H15N5 and a molecular weight of 217.28 g/mol. Its IUPAC name is N-cyclohexyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-amine.
| Compound Name | N-cyclohexyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-amine |
|---|---|
| PubChem CID | 134088447 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | N-cyclohexyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-amine |
| SMILES | c1cnc2nnc(NC3CCCCC3)n2c1 |
| InChI | InChI=1S/C11H15N5/c1-2-5-9(6-3-1)13-11-15-14-10-12-7-4-8-16(10)11/h4,7-9H,1-3,5-6H2,(H,13,15) |
| InChIKey | MZICGSXJNAQVOT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |