C16H22Cl2N2 — CID 115926469
4,6-dichloro-2-cycloheptyl-5-cyclopentylpyrimidine (PubChem CID 115926469) has the molecular formula C16H22Cl2N2 and a molecular weight of 313.27 g/mol. Its IUPAC name is 4,6-dichloro-2-cycloheptyl-5-cyclopentylpyrimidine.
| Compound Name | 4,6-dichloro-2-cycloheptyl-5-cyclopentylpyrimidine |
|---|---|
| PubChem CID | 115926469 |
| Molecular Formula | C16H22Cl2N2 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 4,6-dichloro-2-cycloheptyl-5-cyclopentylpyrimidine |
| SMILES | Clc1nc(C2CCCCCC2)nc(Cl)c1C1CCCC1 |
| InChI | InChI=1S/C16H22Cl2N2/c17-14-13(11-7-5-6-8-11)15(18)20-16(19-14)12-9-3-1-2-4-10-12/h11-12H,1-10H2 |
| InChIKey | GTHWGBTZKUUDJX-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |