C9H11Cl2N3 — CID 154164394
4,6-dichloro-5-cyclohexyltriazine (PubChem CID 154164394) has the molecular formula C9H11Cl2N3 and a molecular weight of 232.11 g/mol. Its IUPAC name is 4,6-dichloro-5-cyclohexyltriazine.
| Compound Name | 4,6-dichloro-5-cyclohexyltriazine |
|---|---|
| PubChem CID | 154164394 |
| Molecular Formula | C9H11Cl2N3 |
| Molecular Weight | 232.11 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 4,6-dichloro-5-cyclohexyltriazine |
| SMILES | Clc1nnnc(Cl)c1C1CCCCC1 |
| InChI | InChI=1S/C9H11Cl2N3/c10-8-7(9(11)13-14-12-8)6-4-2-1-3-5-6/h6H,1-5H2 |
| InChIKey | IMEWDRCLQMBAMW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.11 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |