C9H13ClN2S — CID 63386353
2-chloro-5-cycloheptyl-1,3,4-thiadiazole (PubChem CID 63386353) has the molecular formula C9H13ClN2S and a molecular weight of 216.74 g/mol. Its IUPAC name is 2-chloro-5-cycloheptyl-1,3,4-thiadiazole.
| Compound Name | 2-chloro-5-cycloheptyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 63386353 |
| Molecular Formula | C9H13ClN2S |
| Molecular Weight | 216.74 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 2-chloro-5-cycloheptyl-1,3,4-thiadiazole |
| SMILES | Clc1nnc(C2CCCCCC2)s1 |
| InChI | InChI=1S/C9H13ClN2S/c10-9-12-11-8(13-9)7-5-3-1-2-4-6-7/h7H,1-6H2 |
| InChIKey | HRTHNFBYDMCLMA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.74 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |