C11H13Cl3N2 — CID 112569410
4,6-dichloro-2-(1-chloroethyl)-5-cyclopentylpyrimidine (PubChem CID 112569410) has the molecular formula C11H13Cl3N2 and a molecular weight of 279.60 g/mol. Its IUPAC name is 4,6-dichloro-2-(1-chloroethyl)-5-cyclopentylpyrimidine.
| Compound Name | 4,6-dichloro-2-(1-chloroethyl)-5-cyclopentylpyrimidine |
|---|---|
| PubChem CID | 112569410 |
| Molecular Formula | C11H13Cl3N2 |
| Molecular Weight | 279.60 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | 4,6-dichloro-2-(1-chloroethyl)-5-cyclopentylpyrimidine |
| SMILES | CC(Cl)c1nc(Cl)c(C2CCCC2)c(Cl)n1 |
| InChI | InChI=1S/C11H13Cl3N2/c1-6(12)11-15-9(13)8(10(14)16-11)7-4-2-3-5-7/h6-7H,2-5H2,1H3 |
| InChIKey | FHVCIRZOOKFMDJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.60 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|