C10H11Cl2FN2 — CID 80550143
4,6-dichloro-2-cyclohexyl-5-fluoropyrimidine (PubChem CID 80550143) has the molecular formula C10H11Cl2FN2 and a molecular weight of 249.12 g/mol. Its IUPAC name is 4,6-dichloro-2-cyclohexyl-5-fluoropyrimidine.
| Compound Name | 4,6-dichloro-2-cyclohexyl-5-fluoropyrimidine |
|---|---|
| PubChem CID | 80550143 |
| Molecular Formula | C10H11Cl2FN2 |
| Molecular Weight | 249.12 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 4,6-dichloro-2-cyclohexyl-5-fluoropyrimidine |
| SMILES | Fc1c(Cl)nc(C2CCCCC2)nc1Cl |
| InChI | InChI=1S/C10H11Cl2FN2/c11-8-7(13)9(12)15-10(14-8)6-4-2-1-3-5-6/h6H,1-5H2 |
| InChIKey | BBMNHPLXONMKLP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.12 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |