About 4-chloro-2-cyclopentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine
4-chloro-2-cyclopentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine (PubChem CID 59362936) has the molecular formula C12H15ClN2
and a molecular weight of 222.72 g/mol. Its IUPAC name is 4-chloro-2-cyclopentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine.
Molecular Properties
| Compound Name | 4-chloro-2-cyclopentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine |
| PubChem CID | 59362936 |
| Molecular Formula | C12H15ClN2 |
| Molecular Weight | 222.72 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 4-chloro-2-cyclopentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine |
| SMILES | Clc1nc(C2CCCC2)nc2c1CCC2 |
| InChI | InChI=1S/C12H15ClN2/c13-11-9-6-3-7-10(9)14-12(15-11)8-4-1-2-5-8/h8H,1-7H2 |
| InChIKey | PDRKSSGKRMTIEK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.72 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-2-cyclopentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-cyclopentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine?
The IUPAC name of 4-chloro-2-cyclopentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine (CID 59362936) is 4-chloro-2-cyclopentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine.
What is the SMILES notation for 4-chloro-2-cyclopentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine?
The canonical SMILES for 4-chloro-2-cyclopentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine is Clc1nc(C2CCCC2)nc2c1CCC2.
What is the InChIKey of 4-chloro-2-cyclopentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine?
The InChIKey is PDRKSSGKRMTIEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClN2/c13-11-9-6-3-7-10(9)14-12(15-11)8-4-1-2-5-8/h8H,1-7H2.
What are the key properties of 4-chloro-2-cyclopentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine?
4-chloro-2-cyclopentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine has a molecular weight of 222.72 g/mol, XLogP of 3.28, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-cyclopentyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine is sourced from PubChem (CID 59362936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).