C8H9ClN2O2S — CID 117105014
3-(5-chloropyridazin-3-yl)thiolane 1,1-dioxide (PubChem CID 117105014) has the molecular formula C8H9ClN2O2S and a molecular weight of 232.69 g/mol. Its IUPAC name is 3-(5-chloropyridazin-3-yl)thiolane 1,1-dioxide.
| Compound Name | 3-(5-chloropyridazin-3-yl)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 117105014 |
| Molecular Formula | C8H9ClN2O2S |
| Molecular Weight | 232.69 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | 3-(5-chloropyridazin-3-yl)thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(c2cc(Cl)cnn2)C1 |
| InChI | InChI=1S/C8H9ClN2O2S/c9-7-3-8(11-10-4-7)6-1-2-14(12,13)5-6/h3-4,6H,1-2,5H2 |
| InChIKey | KDNNTGOXHOQXFY-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.69 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |