C9H12N2O2S — CID 115027948
5-(1,1-dioxothiolan-3-yl)pyridin-3-amine (PubChem CID 115027948) has the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. Its IUPAC name is 5-(1,1-dioxothiolan-3-yl)pyridin-3-amine.
| Compound Name | 5-(1,1-dioxothiolan-3-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 115027948 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 5-(1,1-dioxothiolan-3-yl)pyridin-3-amine |
| SMILES | Nc1cncc(C2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C9H12N2O2S/c10-9-3-8(4-11-5-9)7-1-2-14(12,13)6-7/h3-5,7H,1-2,6,10H2 |
| InChIKey | IZCGPQWMFLGQIY-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |