C10H15N3O2S — CID 104534161
5-N-[(1,1-dioxothiolan-3-yl)methyl]pyridine-3,5-diamine (PubChem CID 104534161) has the molecular formula C10H15N3O2S and a molecular weight of 241.32 g/mol. Its IUPAC name is 5-N-[(1,1-dioxothiolan-3-yl)methyl]pyridine-3,5-diamine.
| Compound Name | 5-N-[(1,1-dioxothiolan-3-yl)methyl]pyridine-3,5-diamine |
|---|---|
| PubChem CID | 104534161 |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 5-N-[(1,1-dioxothiolan-3-yl)methyl]pyridine-3,5-diamine |
| SMILES | Nc1cncc(NCC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C10H15N3O2S/c11-9-3-10(6-12-5-9)13-4-8-1-2-16(14,15)7-8/h3,5-6,8,13H,1-2,4,7,11H2 |
| InChIKey | OEALIDHFVCEQEF-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |