C11H15ClN2O2S — CID 115468877
4-chloro-2-N-[(1,1-dioxothiolan-3-yl)methyl]benzene-1,2-diamine (PubChem CID 115468877) has the molecular formula C11H15ClN2O2S and a molecular weight of 274.77 g/mol. Its IUPAC name is 4-chloro-2-N-[(1,1-dioxothiolan-3-yl)methyl]benzene-1,2-diamine.
| Compound Name | 4-chloro-2-N-[(1,1-dioxothiolan-3-yl)methyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 115468877 |
| Molecular Formula | C11H15ClN2O2S |
| Molecular Weight | 274.77 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 4-chloro-2-N-[(1,1-dioxothiolan-3-yl)methyl]benzene-1,2-diamine |
| SMILES | Nc1ccc(Cl)cc1NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H15ClN2O2S/c12-9-1-2-10(13)11(5-9)14-6-8-3-4-17(15,16)7-8/h1-2,5,8,14H,3-4,6-7,13H2 |
| InChIKey | NUDWTJKLQXEQRT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.77 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|