C10H14ClN3O2S — CID 113316900
6-chloro-2-N-[(1,1-dioxothiolan-3-yl)methyl]pyridine-2,3-diamine (PubChem CID 113316900) has the molecular formula C10H14ClN3O2S and a molecular weight of 275.76 g/mol. Its IUPAC name is 6-chloro-2-N-[(1,1-dioxothiolan-3-yl)methyl]pyridine-2,3-diamine.
| Compound Name | 6-chloro-2-N-[(1,1-dioxothiolan-3-yl)methyl]pyridine-2,3-diamine |
|---|---|
| PubChem CID | 113316900 |
| Molecular Formula | C10H14ClN3O2S |
| Molecular Weight | 275.76 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 6-chloro-2-N-[(1,1-dioxothiolan-3-yl)methyl]pyridine-2,3-diamine |
| SMILES | Nc1ccc(Cl)nc1NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H14ClN3O2S/c11-9-2-1-8(12)10(14-9)13-5-7-3-4-17(15,16)6-7/h1-2,7H,3-6,12H2,(H,13,14) |
| InChIKey | MTAIOEWIFBGUMZ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.76 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|